C19H23NO3 — CID 57278925
[2-(3-methoxyphenyl)phenyl]methyl N,N-diethylcarbamate (PubChem CID 57278925) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)phenyl]methyl N,N-diethylcarbamate.
| Compound Name | [2-(3-methoxyphenyl)phenyl]methyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 57278925 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [2-(3-methoxyphenyl)phenyl]methyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCc1ccccc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C19H23NO3/c1-4-20(5-2)19(21)23-14-16-9-6-7-12-18(16)15-10-8-11-17(13-15)22-3/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | VGEHATAILMYDIQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |