C20H17NO5 — CID 58067690
5-hydroxy-1-[[2-(3-methoxyphenyl)phenyl]methyl]-4-oxopyridine-3-carboxylic acid (PubChem CID 58067690) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 5-hydroxy-1-[[2-(3-methoxyphenyl)phenyl]methyl]-4-oxopyridine-3-carboxylic acid.
| Compound Name | 5-hydroxy-1-[[2-(3-methoxyphenyl)phenyl]methyl]-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58067690 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 5-hydroxy-1-[[2-(3-methoxyphenyl)phenyl]methyl]-4-oxopyridine-3-carboxylic acid |
| SMILES | COc1cccc(-c2ccccc2Cn2cc(O)c(=O)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C20H17NO5/c1-26-15-7-4-6-13(9-15)16-8-3-2-5-14(16)10-21-11-17(20(24)25)19(23)18(22)12-21/h2-9,11-12,22H,10H2,1H3,(H,24,25) |
| InChIKey | GXXDDBISWQDCGW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |