C28H23NO3 — CID 141266731
3-(2-hydroxy-4-methoxyphenyl)-1-[(2-phenylphenyl)methyl]-3H-indol-2-one (PubChem CID 141266731) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-(2-hydroxy-4-methoxyphenyl)-1-[(2-phenylphenyl)methyl]-3H-indol-2-one.
| Compound Name | 3-(2-hydroxy-4-methoxyphenyl)-1-[(2-phenylphenyl)methyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 141266731 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-(2-hydroxy-4-methoxyphenyl)-1-[(2-phenylphenyl)methyl]-3H-indol-2-one |
| SMILES | COc1ccc(C2C(=O)N(Cc3ccccc3-c3ccccc3)c3ccccc32)c(O)c1 |
| InChI | InChI=1S/C28H23NO3/c1-32-21-15-16-24(26(30)17-21)27-23-13-7-8-14-25(23)29(28(27)31)18-20-11-5-6-12-22(20)19-9-3-2-4-10-19/h2-17,27,30H,18H2,1H3 |
| InChIKey | FFWBESCETSGUGC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |