C14H17F2NO3 — CID 101052875
[2,2-difluoro-1-(3-methoxyphenyl)ethenyl] N,N-diethylcarbamate (PubChem CID 101052875) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is [2,2-difluoro-1-(3-methoxyphenyl)ethenyl] N,N-diethylcarbamate.
| Compound Name | [2,2-difluoro-1-(3-methoxyphenyl)ethenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 101052875 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [2,2-difluoro-1-(3-methoxyphenyl)ethenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC(=C(F)F)c1cccc(OC)c1 |
| InChI | InChI=1S/C14H17F2NO3/c1-4-17(5-2)14(18)20-12(13(15)16)10-7-6-8-11(9-10)19-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | MUAGRNJSZTYJOQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|