C12H17NO2S — CID 10847603
S-(3-methoxyphenyl) N,N-diethylcarbamothioate (PubChem CID 10847603) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is S-(3-methoxyphenyl) N,N-diethylcarbamothioate.
| Compound Name | S-(3-methoxyphenyl) N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 10847603 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | S-(3-methoxyphenyl) N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=O)Sc1cccc(OC)c1 |
| InChI | InChI=1S/C12H17NO2S/c1-4-13(5-2)12(14)16-11-8-6-7-10(9-11)15-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | XCCFARHKNURUBA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|