C27H29Br2NO2 — CID 44552085
[2,6-bis(3-bromophenyl)-4-tert-butylphenyl] N,N-diethylcarbamate (PubChem CID 44552085) has the molecular formula C27H29Br2NO2 and a molecular weight of 559.34 g/mol. Its IUPAC name is [2,6-bis(3-bromophenyl)-4-tert-butylphenyl] N,N-diethylcarbamate.
| Compound Name | [2,6-bis(3-bromophenyl)-4-tert-butylphenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 44552085 |
| Molecular Formula | C27H29Br2NO2 |
| Molecular Weight | 559.34 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | [2,6-bis(3-bromophenyl)-4-tert-butylphenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1c(-c2cccc(Br)c2)cc(C(C)(C)C)cc1-c1cccc(Br)c1 |
| InChI | InChI=1S/C27H29Br2NO2/c1-6-30(7-2)26(31)32-25-23(18-10-8-12-21(28)14-18)16-20(27(3,4)5)17-24(25)19-11-9-13-22(29)15-19/h8-17H,6-7H2,1-5H3 |
| InChIKey | YKUNSFMXQZGPHK-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.34 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |