C33H25Cl2N3O4 — CID 69154073
N-(6-amino-2-pyridinyl)-2-[(2-chlorophenyl)methoxy]-N-[2-[(2-chlorophenyl)methoxy]benzoyl]benzamide (PubChem CID 69154073) has the molecular formula C33H25Cl2N3O4 and a molecular weight of 598.49 g/mol. Its IUPAC name is N-(6-amino-2-pyridinyl)-2-[(2-chlorophenyl)methoxy]-N-[2-[(2-chlorophenyl)methoxy]benzoyl]benzamide.
| Compound Name | N-(6-amino-2-pyridinyl)-2-[(2-chlorophenyl)methoxy]-N-[2-[(2-chlorophenyl)methoxy]benzoyl]benzamide |
|---|---|
| PubChem CID | 69154073 |
| Molecular Formula | C33H25Cl2N3O4 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | N-(6-amino-2-pyridinyl)-2-[(2-chlorophenyl)methoxy]-N-[2-[(2-chlorophenyl)methoxy]benzoyl]benzamide |
| SMILES | Nc1cccc(N(C(=O)c2ccccc2OCc2ccccc2Cl)C(=O)c2ccccc2OCc2ccccc2Cl)n1 |
| InChI | InChI=1S/C33H25Cl2N3O4/c34-26-14-5-1-10-22(26)20-41-28-16-7-3-12-24(28)32(39)38(31-19-9-18-30(36)37-31)33(40)25-13-4-8-17-29(25)42-21-23-11-2-6-15-27(23)35/h1-19H,20-21H2,(H2,36,37) |
| InChIKey | AJFRXOKGIALFBC-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|