C23H18Cl2O4 — CID 23590494
1-[2,3-bis[(2-chlorophenyl)methoxy]phenyl]propane-1,2-dione (PubChem CID 23590494) has the molecular formula C23H18Cl2O4 and a molecular weight of 429.30 g/mol. Its IUPAC name is 1-[2,3-bis[(2-chlorophenyl)methoxy]phenyl]propane-1,2-dione.
| Compound Name | 1-[2,3-bis[(2-chlorophenyl)methoxy]phenyl]propane-1,2-dione |
|---|---|
| PubChem CID | 23590494 |
| Molecular Formula | C23H18Cl2O4 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 1-[2,3-bis[(2-chlorophenyl)methoxy]phenyl]propane-1,2-dione |
| SMILES | CC(=O)C(=O)c1cccc(OCc2ccccc2Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C23H18Cl2O4/c1-15(26)22(27)18-9-6-12-21(28-13-16-7-2-4-10-19(16)24)23(18)29-14-17-8-3-5-11-20(17)25/h2-12H,13-14H2,1H3 |
| InChIKey | NGNNBIAJJYDBKU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|