C16H17ClO3 — CID 4736676
[2-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methanol (PubChem CID 4736676) has the molecular formula C16H17ClO3 and a molecular weight of 292.76 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methanol.
| Compound Name | [2-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methanol |
|---|---|
| PubChem CID | 4736676 |
| Molecular Formula | C16H17ClO3 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [2-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methanol |
| SMILES | CCOc1cccc(CO)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C16H17ClO3/c1-2-19-15-9-5-7-12(10-18)16(15)20-11-13-6-3-4-8-14(13)17/h3-9,18H,2,10-11H2,1H3 |
| InChIKey | SXARRLZDPRKNMN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |