C22H17Cl2NO2 — CID 23590504
1,2-bis[(2-chlorophenyl)methoxy]-3-(isocyanomethyl)benzene (PubChem CID 23590504) has the molecular formula C22H17Cl2NO2 and a molecular weight of 398.29 g/mol. Its IUPAC name is 1,2-bis[(2-chlorophenyl)methoxy]-3-(isocyanomethyl)benzene.
| Compound Name | 1,2-bis[(2-chlorophenyl)methoxy]-3-(isocyanomethyl)benzene |
|---|---|
| PubChem CID | 23590504 |
| Molecular Formula | C22H17Cl2NO2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1,2-bis[(2-chlorophenyl)methoxy]-3-(isocyanomethyl)benzene |
| SMILES | [C-]#[N+]Cc1cccc(OCc2ccccc2Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H17Cl2NO2/c1-25-13-16-9-6-12-21(26-14-17-7-2-4-10-19(17)23)22(16)27-15-18-8-3-5-11-20(18)24/h2-12H,13-15H2 |
| InChIKey | JESAZEOLXDXXNH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|