C11H5N3OS — CID 90715403
3-(1,3-thiazol-2-yloxy)benzene-1,2-dicarbonitrile (PubChem CID 90715403) has the molecular formula C11H5N3OS and a molecular weight of 227.25 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yloxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3-(1,3-thiazol-2-yloxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 90715403 |
| Molecular Formula | C11H5N3OS |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 3-(1,3-thiazol-2-yloxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(Oc2nccs2)c1C#N |
| InChI | InChI=1S/C11H5N3OS/c12-6-8-2-1-3-10(9(8)7-13)15-11-14-4-5-16-11/h1-5H |
| InChIKey | YOVVFZHQUTUFRW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |