C7H10N2O2S — CID 174620445
1,3-thiazol-2-yl N-ethyl-N-methylcarbamate (PubChem CID 174620445) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 1,3-thiazol-2-yl N-ethyl-N-methylcarbamate.
| Compound Name | 1,3-thiazol-2-yl N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 174620445 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 1,3-thiazol-2-yl N-ethyl-N-methylcarbamate |
| SMILES | CCN(C)C(=O)Oc1nccs1 |
| InChI | InChI=1S/C7H10N2O2S/c1-3-9(2)7(10)11-6-8-4-5-12-6/h4-5H,3H2,1-2H3 |
| InChIKey | MSCFXQLXNOTRSU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |