C16H20N2O5 — CID 170922511
propyl 4-[(1-ethoxy-1,3-dioxobutan-2-yl)diazenyl]benzoate (PubChem CID 170922511) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is propyl 4-[(1-ethoxy-1,3-dioxobutan-2-yl)diazenyl]benzoate.
| Compound Name | propyl 4-[(1-ethoxy-1,3-dioxobutan-2-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 170922511 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | propyl 4-[(1-ethoxy-1,3-dioxobutan-2-yl)diazenyl]benzoate |
| SMILES | CCCOC(=O)c1ccc(/N=N/C(C(C)=O)C(=O)OCC)cc1 |
| InChI | InChI=1S/C16H20N2O5/c1-4-10-23-15(20)12-6-8-13(9-7-12)17-18-14(11(3)19)16(21)22-5-2/h6-9,14H,4-5,10H2,1-3H3/b18-17+ |
| InChIKey | YIHYXKILPLQJPL-ISLYRVAYSA-N |
| XLogP | 2.86 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|