C18H20N2O7 — CID 91488088
methyl 4-[[1-(3-ethoxy-2-methyl-3-oxoprop-1-enoxy)-1,3-dioxobutan-2-yl]diazenyl]benzoate (PubChem CID 91488088) has the molecular formula C18H20N2O7 and a molecular weight of 376.37 g/mol. Its IUPAC name is methyl 4-[[1-(3-ethoxy-2-methyl-3-oxoprop-1-enoxy)-1,3-dioxobutan-2-yl]diazenyl]benzoate.
| Compound Name | methyl 4-[[1-(3-ethoxy-2-methyl-3-oxoprop-1-enoxy)-1,3-dioxobutan-2-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 91488088 |
| Molecular Formula | C18H20N2O7 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | methyl 4-[[1-(3-ethoxy-2-methyl-3-oxoprop-1-enoxy)-1,3-dioxobutan-2-yl]diazenyl]benzoate |
| SMILES | CCOC(=O)C(C)=COC(=O)C(/N=N/c1ccc(C(=O)OC)cc1)C(C)=O |
| InChI | InChI=1S/C18H20N2O7/c1-5-26-16(22)11(2)10-27-18(24)15(12(3)21)20-19-14-8-6-13(7-9-14)17(23)25-4/h6-10,15H,5H2,1-4H3/b11-10?,20-19+ |
| InChIKey | APEJPCHIEUTXPH-SOBSTXOFSA-N |
| XLogP | 2.52 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|