About ethyl 2-methyl-5-oxopentanoate
ethyl 2-methyl-5-oxopentanoate (PubChem CID 57121376) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is ethyl 2-methyl-5-oxopentanoate.
Molecular Properties
| Compound Name | ethyl 2-methyl-5-oxopentanoate |
| PubChem CID | 57121376 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | ethyl 2-methyl-5-oxopentanoate |
| SMILES | CCOC(=O)C(C)CCC=O |
| InChI | InChI=1S/C8H14O3/c1-3-11-8(10)7(2)5-4-6-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | NOFXCIBVNCFKMV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methyl-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-5-oxopentanoate?
The IUPAC name of ethyl 2-methyl-5-oxopentanoate (CID 57121376) is ethyl 2-methyl-5-oxopentanoate.
What is the SMILES notation for ethyl 2-methyl-5-oxopentanoate?
The canonical SMILES for ethyl 2-methyl-5-oxopentanoate is CCOC(=O)C(C)CCC=O.
What is the InChIKey of ethyl 2-methyl-5-oxopentanoate?
The InChIKey is NOFXCIBVNCFKMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-11-8(10)7(2)5-4-6-9/h6-7H,3-5H2,1-2H3.
What are the key properties of ethyl 2-methyl-5-oxopentanoate?
ethyl 2-methyl-5-oxopentanoate has a molecular weight of 158.20 g/mol, XLogP of 1.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-5-oxopentanoate is sourced from PubChem (CID 57121376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).