C8H13NO3 — CID 19880553
2-methyl-4,5-dioxoheptanamide (PubChem CID 19880553) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-methyl-4,5-dioxoheptanamide.
| Compound Name | 2-methyl-4,5-dioxoheptanamide |
|---|---|
| PubChem CID | 19880553 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2-methyl-4,5-dioxoheptanamide |
| SMILES | CCC(=O)C(=O)CC(C)C(N)=O |
| InChI | InChI=1S/C8H13NO3/c1-3-6(10)7(11)4-5(2)8(9)12/h5H,3-4H2,1-2H3,(H2,9,12) |
| InChIKey | POCKIAPXDKJLGM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|