C8H18N2 — CID 91477509
2,3-dimethyl-1-(methylideneamino)pentan-1-amine (PubChem CID 91477509) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 2,3-dimethyl-1-(methylideneamino)pentan-1-amine.
| Compound Name | 2,3-dimethyl-1-(methylideneamino)pentan-1-amine |
|---|---|
| PubChem CID | 91477509 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2,3-dimethyl-1-(methylideneamino)pentan-1-amine |
| SMILES | C=NC(N)C(C)C(C)CC |
| InChI | InChI=1S/C8H18N2/c1-5-6(2)7(3)8(9)10-4/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | BTWDPAISPLRENU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|