C6H16N2S2 — CID 91505662
3,4-diaminohexane-1,1-dithiol (PubChem CID 91505662) has the molecular formula C6H16N2S2 and a molecular weight of 180.34 g/mol. Its IUPAC name is 3,4-diaminohexane-1,1-dithiol.
| Compound Name | 3,4-diaminohexane-1,1-dithiol |
|---|---|
| PubChem CID | 91505662 |
| Molecular Formula | C6H16N2S2 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3,4-diaminohexane-1,1-dithiol |
| SMILES | CCC(N)C(N)CC(S)S |
| InChI | InChI=1S/C6H16N2S2/c1-2-4(7)5(8)3-6(9)10/h4-6,9-10H,2-3,7-8H2,1H3 |
| InChIKey | CHFPQMUDBINDPC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|