C11H27N3S — CID 174307812
4,8-diamino-7-(methylamino)decane-5-thiol (PubChem CID 174307812) has the molecular formula C11H27N3S and a molecular weight of 233.42 g/mol. Its IUPAC name is 4,8-diamino-7-(methylamino)decane-5-thiol.
| Compound Name | 4,8-diamino-7-(methylamino)decane-5-thiol |
|---|---|
| PubChem CID | 174307812 |
| Molecular Formula | C11H27N3S |
| Molecular Weight | 233.42 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 4,8-diamino-7-(methylamino)decane-5-thiol |
| SMILES | CCCC(N)C(S)CC(NC)C(N)CC |
| InChI | InChI=1S/C11H27N3S/c1-4-6-9(13)11(15)7-10(14-3)8(12)5-2/h8-11,14-15H,4-7,12-13H2,1-3H3 |
| InChIKey | UOASXVRDXGFYQF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|