C7H14O6 — CID 102589824
(3R,4R,5S)-1,3,4,5,6-pentahydroxy-5-methylhexan-2-one (PubChem CID 102589824) has the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. Its IUPAC name is (3R,4R,5S)-1,3,4,5,6-pentahydroxy-5-methylhexan-2-one.
| Compound Name | (3R,4R,5S)-1,3,4,5,6-pentahydroxy-5-methylhexan-2-one |
|---|---|
| PubChem CID | 102589824 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (3R,4R,5S)-1,3,4,5,6-pentahydroxy-5-methylhexan-2-one |
| SMILES | C[C@](O)(CO)[C@H](O)[C@@H](O)C(=O)CO |
| InChI | InChI=1S/C7H14O6/c1-7(13,3-9)6(12)5(11)4(10)2-8/h5-6,8-9,11-13H,2-3H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | NCLYFSQEBHTEAF-XVMARJQXSA-N |
| XLogP | -2.99 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |