C6H14O3 — CID 11007962
(2S,3R)-4,4-dideuterio-2-methylpentane-1,2,3-triol (PubChem CID 11007962) has the molecular formula C6H14O3 and a molecular weight of 136.19 g/mol. Its IUPAC name is (2S,3R)-4,4-dideuterio-2-methylpentane-1,2,3-triol.
| Compound Name | (2S,3R)-4,4-dideuterio-2-methylpentane-1,2,3-triol |
|---|---|
| PubChem CID | 11007962 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | (2S,3R)-4,4-dideuterio-2-methylpentane-1,2,3-triol |
| SMILES | [2H]C([2H])(C)[C@@H](O)[C@@](C)(O)CO |
| InChI | InChI=1S/C6H14O3/c1-3-5(8)6(2,9)4-7/h5,7-9H,3-4H2,1-2H3/t5-,6+/m1/s1/i3D2 |
| InChIKey | AHFMIUJCBUIHCI-SXSBMYDASA-N |
| XLogP | -0.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |