C10H20O5 — CID 100915932
(2S,3S)-2-methyl-6-methylideneoctane-1,2,3,7,8-pentol (PubChem CID 100915932) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is (2S,3S)-2-methyl-6-methylideneoctane-1,2,3,7,8-pentol.
| Compound Name | (2S,3S)-2-methyl-6-methylideneoctane-1,2,3,7,8-pentol |
|---|---|
| PubChem CID | 100915932 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2S,3S)-2-methyl-6-methylideneoctane-1,2,3,7,8-pentol |
| SMILES | C=C(CC[C@H](O)[C@@](C)(O)CO)C(O)CO |
| InChI | InChI=1S/C10H20O5/c1-7(8(13)5-11)3-4-9(14)10(2,15)6-12/h8-9,11-15H,1,3-6H2,2H3/t8?,9-,10-/m0/s1 |
| InChIKey | HWSDPJWYWJYJLF-AGROOBSYSA-N |
| XLogP | -1.22 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|