C30H62O12 — CID 134974140
(3R,6R,7R,10R,11R,14R,15R,18R,19R,22R)-2,6,10,15,19,23-hexamethyltetracosane-2,3,6,7,10,11,14,15,18,19,22,23-dodecol (PubChem CID 134974140) has the molecular formula C30H62O12 and a molecular weight of 614.81 g/mol. Its IUPAC name is (3R,6R,7R,10R,11R,14R,15R,18R,19R,22R)-2,6,10,15,19,23-hexamethyltetracosane-2,3,6,7,10,11,14,15,18,19,22,23-dodecol.
| Compound Name | (3R,6R,7R,10R,11R,14R,15R,18R,19R,22R)-2,6,10,15,19,23-hexamethyltetracosane-2,3,6,7,10,11,14,15,18,19,22,23-dodecol |
|---|---|
| PubChem CID | 134974140 |
| Molecular Formula | C30H62O12 |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.42 |
| IUPAC Name | (3R,6R,7R,10R,11R,14R,15R,18R,19R,22R)-2,6,10,15,19,23-hexamethyltetracosane-2,3,6,7,10,11,14,15,18,19,22,23-dodecol |
| SMILES | CC(C)(O)[C@H](O)CC[C@@](C)(O)[C@H](O)CC[C@@](C)(O)[C@H](O)CC[C@@H](O)[C@](C)(O)CC[C@@H](O)[C@](C)(O)CC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C30H62O12/c1-25(2,37)19(31)11-15-29(7,41)23(35)13-17-27(5,39)21(33)9-10-22(34)28(6,40)18-14-24(36)30(8,42)16-12-20(32)26(3,4)38/h19-24,31-42H,9-18H2,1-8H3/t19-,20-,21-,22-,23-,24-,27-,28-,29-,30-/m1/s1 |
| InChIKey | XGAJABKORPAREO-WYLMOPAYSA-N |
| XLogP | -0.40 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |