C12H26O2 — CID 114496700
2,2,6,7-tetramethyloctane-3,6-diol (PubChem CID 114496700) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2,2,6,7-tetramethyloctane-3,6-diol.
| Compound Name | 2,2,6,7-tetramethyloctane-3,6-diol |
|---|---|
| PubChem CID | 114496700 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 2,2,6,7-tetramethyloctane-3,6-diol |
| SMILES | CC(C)C(C)(O)CCC(O)C(C)(C)C |
| InChI | InChI=1S/C12H26O2/c1-9(2)12(6,14)8-7-10(13)11(3,4)5/h9-10,13-14H,7-8H2,1-6H3 |
| InChIKey | QETPJGFRFBLBFN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |