C21H44O2 — CID 162768133
3,9-ditert-butyl-6,6-dimethylundecane-2,10-diol (PubChem CID 162768133) has the molecular formula C21H44O2 and a molecular weight of 328.58 g/mol. Its IUPAC name is 3,9-ditert-butyl-6,6-dimethylundecane-2,10-diol.
| Compound Name | 3,9-ditert-butyl-6,6-dimethylundecane-2,10-diol |
|---|---|
| PubChem CID | 162768133 |
| Molecular Formula | C21H44O2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.33 |
| IUPAC Name | 3,9-ditert-butyl-6,6-dimethylundecane-2,10-diol |
| SMILES | CC(O)C(CCC(C)(C)CCC(C(C)O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H44O2/c1-15(22)17(19(3,4)5)11-13-21(9,10)14-12-18(16(2)23)20(6,7)8/h15-18,22-23H,11-14H2,1-10H3 |
| InChIKey | DTUFJBNPGPSTMW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |