C13H28O2 — CID 89346944
(3R,9S)-6,6-dimethylundecane-3,9-diol (PubChem CID 89346944) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is (3R,9S)-6,6-dimethylundecane-3,9-diol.
| Compound Name | (3R,9S)-6,6-dimethylundecane-3,9-diol |
|---|---|
| PubChem CID | 89346944 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | (3R,9S)-6,6-dimethylundecane-3,9-diol |
| SMILES | CC[C@@H](O)CCC(C)(C)CC[C@@H](O)CC |
| InChI | InChI=1S/C13H28O2/c1-5-11(14)7-9-13(3,4)10-8-12(15)6-2/h11-12,14-15H,5-10H2,1-4H3/t11-,12+ |
| InChIKey | TTZPSCHAUUZWTQ-TXEJJXNPSA-N |
| XLogP | 3.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |