C15H32O2 — CID 174442476
7,8,8,9,9-pentamethyldecane-3,7-diol (PubChem CID 174442476) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 7,8,8,9,9-pentamethyldecane-3,7-diol.
| Compound Name | 7,8,8,9,9-pentamethyldecane-3,7-diol |
|---|---|
| PubChem CID | 174442476 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 7,8,8,9,9-pentamethyldecane-3,7-diol |
| SMILES | CCC(O)CCCC(C)(O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O2/c1-8-12(16)10-9-11-15(7,17)14(5,6)13(2,3)4/h12,16-17H,8-11H2,1-7H3 |
| InChIKey | ZXBLEZDHHICITN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |