C12H30O4Si2 — CID 123497948
2,6,6-trimethyl-7,7-bis(methylsilyloxy)heptane-2,3-diol (PubChem CID 123497948) has the molecular formula C12H30O4Si2 and a molecular weight of 294.54 g/mol. Its IUPAC name is 2,6,6-trimethyl-7,7-bis(methylsilyloxy)heptane-2,3-diol.
| Compound Name | 2,6,6-trimethyl-7,7-bis(methylsilyloxy)heptane-2,3-diol |
|---|---|
| PubChem CID | 123497948 |
| Molecular Formula | C12H30O4Si2 |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2,6,6-trimethyl-7,7-bis(methylsilyloxy)heptane-2,3-diol |
| SMILES | C[SiH2]OC(O[SiH2]C)C(C)(C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C12H30O4Si2/c1-11(2,10(15-17-5)16-18-6)8-7-9(13)12(3,4)14/h9-10,13-14H,7-8,17-18H2,1-6H3 |
| InChIKey | STTFJIFHPKOLFC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|