C14H34O3Si2 — CID 173463913
(2S,3S)-3-[2-methyl-1,1-bis(methylsilyloxy)propan-2-yl]octan-2-ol (PubChem CID 173463913) has the molecular formula C14H34O3Si2 and a molecular weight of 306.60 g/mol. Its IUPAC name is (2S,3S)-3-[2-methyl-1,1-bis(methylsilyloxy)propan-2-yl]octan-2-ol.
| Compound Name | (2S,3S)-3-[2-methyl-1,1-bis(methylsilyloxy)propan-2-yl]octan-2-ol |
|---|---|
| PubChem CID | 173463913 |
| Molecular Formula | C14H34O3Si2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (2S,3S)-3-[2-methyl-1,1-bis(methylsilyloxy)propan-2-yl]octan-2-ol |
| SMILES | CCCCC[C@H]([C@H](C)O)C(C)(C)C(O[SiH2]C)O[SiH2]C |
| InChI | InChI=1S/C14H34O3Si2/c1-7-8-9-10-12(11(2)15)14(3,4)13(16-18-5)17-19-6/h11-13,15H,7-10,18-19H2,1-6H3/t11-,12+/m0/s1 |
| InChIKey | AIQJCIJHFDPTJI-NWDGAFQWSA-N |
| XLogP | 2.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|