C13H18O6 — CID 174661135
3,4,5,6-tetrahydroxy-3-(4-methoxyphenyl)hexan-2-one (PubChem CID 174661135) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-3-(4-methoxyphenyl)hexan-2-one.
| Compound Name | 3,4,5,6-tetrahydroxy-3-(4-methoxyphenyl)hexan-2-one |
|---|---|
| PubChem CID | 174661135 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-3-(4-methoxyphenyl)hexan-2-one |
| SMILES | COc1ccc(C(O)(C(C)=O)C(O)C(O)CO)cc1 |
| InChI | InChI=1S/C13H18O6/c1-8(15)13(18,12(17)11(16)7-14)9-3-5-10(19-2)6-4-9/h3-6,11-12,14,16-18H,7H2,1-2H3 |
| InChIKey | YMPZVDOKPFNUIC-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |