C5H9F3O4 — CID 122371749
(2S,3R,4R)-5,5,5-trifluoropentane-1,2,3,4-tetrol (PubChem CID 122371749) has the molecular formula C5H9F3O4 and a molecular weight of 190.12 g/mol. Its IUPAC name is (2S,3R,4R)-5,5,5-trifluoropentane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4R)-5,5,5-trifluoropentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 122371749 |
| Molecular Formula | C5H9F3O4 |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (2S,3R,4R)-5,5,5-trifluoropentane-1,2,3,4-tetrol |
| SMILES | OC[C@H](O)[C@@H](O)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C5H9F3O4/c6-5(7,8)4(12)3(11)2(10)1-9/h2-4,9-12H,1H2/t2-,3+,4+/m0/s1 |
| InChIKey | FZEZUFOKKJEGIJ-PZGQECOJSA-N |
| XLogP | -1.38 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |