C11H26O10 — CID 87333219
2,2-bis(hydroxymethyl)propane-1,3-diol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol (PubChem CID 87333219) has the molecular formula C11H26O10 and a molecular weight of 318.32 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 87333219 |
| Molecular Formula | C11H26O10 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| SMILES | OCC(CO)(CO)CO.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H14O6.C5H12O4/c7-1-3(9)5(11)6(12)4(10)2-8;6-1-5(2-7,3-8)4-9/h3-12H,1-2H2;6-9H,1-4H2/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | DEFPLEIHFSICGX-VFQQELCFSA-N |
| XLogP | -5.64 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -5.64 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |