C9H15NO8 — CID 87861713
(2S,3S,4S,5R)-5-acetamido-2,3,4,5-tetrahydroxy-6-oxoheptanoic acid (PubChem CID 87861713) has the molecular formula C9H15NO8 and a molecular weight of 265.22 g/mol. Its IUPAC name is (2S,3S,4S,5R)-5-acetamido-2,3,4,5-tetrahydroxy-6-oxoheptanoic acid.
| Compound Name | (2S,3S,4S,5R)-5-acetamido-2,3,4,5-tetrahydroxy-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 87861713 |
| Molecular Formula | C9H15NO8 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (2S,3S,4S,5R)-5-acetamido-2,3,4,5-tetrahydroxy-6-oxoheptanoic acid |
| SMILES | CC(=O)N[C@](O)(C(C)=O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C9H15NO8/c1-3(11)9(18,10-4(2)12)7(15)5(13)6(14)8(16)17/h5-7,13-15,18H,1-2H3,(H,10,12)(H,16,17)/t5-,6+,7+,9+/m1/s1 |
| InChIKey | AHDBLKICGHRPSQ-XKBZYTNZSA-N |
| XLogP | -3.43 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|