C6H14B2O10 — CID 90903100
[(2R,3S,4R,5R)-2-borono-2,3,4,5,6-pentahydroxyhexanoyl]boronic acid (PubChem CID 90903100) has the molecular formula C6H14B2O10 and a molecular weight of 267.79 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-borono-2,3,4,5,6-pentahydroxyhexanoyl]boronic acid.
| Compound Name | [(2R,3S,4R,5R)-2-borono-2,3,4,5,6-pentahydroxyhexanoyl]boronic acid |
|---|---|
| PubChem CID | 90903100 |
| Molecular Formula | C6H14B2O10 |
| Molecular Weight | 267.79 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | [(2R,3S,4R,5R)-2-borono-2,3,4,5,6-pentahydroxyhexanoyl]boronic acid |
| SMILES | O=C(B(O)O)[C@@](O)(B(O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14B2O10/c9-1-2(10)3(11)4(12)6(14,8(17)18)5(13)7(15)16/h2-4,9-12,14-18H,1H2/t2-,3-,4+,6-/m1/s1 |
| InChIKey | IAXNIPXFZXNSQG-KAQMDTKVSA-N |
| XLogP | -6.61 |
| TPSA | 199.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.79 |
| LogP ≤ 5 | -6.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|