C7H13ClO6Se — CID 172712977
(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methylselanylhexanoyl chloride (PubChem CID 172712977) has the molecular formula C7H13ClO6Se and a molecular weight of 307.59 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methylselanylhexanoyl chloride.
| Compound Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methylselanylhexanoyl chloride |
|---|---|
| PubChem CID | 172712977 |
| Molecular Formula | C7H13ClO6Se |
| Molecular Weight | 307.59 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methylselanylhexanoyl chloride |
| SMILES | C[Se][C@](O)(C(=O)Cl)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H13ClO6Se/c1-15-7(14,6(8)13)5(12)4(11)3(10)2-9/h3-5,9-12,14H,2H2,1H3/t3-,4-,5+,7+/m1/s1 |
| InChIKey | FMIJPUKWWWAUTG-CXXDYQFHSA-N |
| XLogP | -2.73 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.59 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|