C6H11ClO6 — CID 88726759
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride (PubChem CID 88726759) has the molecular formula C6H11ClO6 and a molecular weight of 214.60 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride |
|---|---|
| PubChem CID | 88726759 |
| Molecular Formula | C6H11ClO6 |
| Molecular Weight | 214.60 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride |
| SMILES | O=C(Cl)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H11ClO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-5,8-12H,1H2/t2-,3+,4+,5-/m1/s1 |
| InChIKey | XXBNLUKLCXTTPH-MGCNEYSASA-N |
| XLogP | -2.81 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.60 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|