(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride

C6H11ClO6 — CID 88726759

IUPAC(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride
SMILESO=C(Cl)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO
InChIInChI=1S/C6H11ClO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-5,8-12H,1H2/t2-,3+,4+,5-/m1/s1
InChIKeyXXBNLUKLCXTTPH-MGCNEYSASA-N
MW214.60 g/mol
LogP-2.81
Rot. Bonds5

About (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride

(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride (PubChem CID 88726759) has the molecular formula C6H11ClO6 and a molecular weight of 214.60 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride.

Molecular Properties

Compound Name(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride
PubChem CID88726759
Molecular FormulaC6H11ClO6
Molecular Weight214.60 g/mol
Exact Mass214.02
IUPAC Name(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride
SMILESO=C(Cl)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO
InChIInChI=1S/C6H11ClO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-5,8-12H,1H2/t2-,3+,4+,5-/m1/s1
InChIKeyXXBNLUKLCXTTPH-MGCNEYSASA-N
XLogP-2.81
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.60
LogP ≤ 5-2.81
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride?
The IUPAC name of (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride (CID 88726759) is (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride.
What is the SMILES notation for (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride?
The canonical SMILES for (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride is O=C(Cl)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO.
What is the InChIKey of (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride?
The InChIKey is XXBNLUKLCXTTPH-MGCNEYSASA-N. The full InChI is InChI=1S/C6H11ClO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-5,8-12H,1H2/t2-,3+,4+,5-/m1/s1.
What are the key properties of (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride?
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride has a molecular weight of 214.60 g/mol, XLogP of -2.81, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl chloride is sourced from PubChem (CID 88726759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).