C5H12B2O9 — CID 123209169
[(2R,3R,4R)-1-borono-2,3,4,5-tetrahydroxy-1-oxopentan-2-yl]boronic acid (PubChem CID 123209169) has the molecular formula C5H12B2O9 and a molecular weight of 237.77 g/mol. Its IUPAC name is [(2R,3R,4R)-1-borono-2,3,4,5-tetrahydroxy-1-oxopentan-2-yl]boronic acid.
| Compound Name | [(2R,3R,4R)-1-borono-2,3,4,5-tetrahydroxy-1-oxopentan-2-yl]boronic acid |
|---|---|
| PubChem CID | 123209169 |
| Molecular Formula | C5H12B2O9 |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | [(2R,3R,4R)-1-borono-2,3,4,5-tetrahydroxy-1-oxopentan-2-yl]boronic acid |
| SMILES | O=C(B(O)O)[C@@](O)(B(O)O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H12B2O9/c8-1-2(9)3(10)5(12,7(15)16)4(11)6(13)14/h2-3,8-10,12-16H,1H2/t2-,3-,5-/m1/s1 |
| InChIKey | PJBSDLYMJKVRIK-PAKKCRSFSA-N |
| XLogP | -5.98 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | -5.98 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|