C13H25NO8 — CID 144965055
ethane;(Z)-4-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-4-oxobut-2-enoic acid (PubChem CID 144965055) has the molecular formula C13H25NO8 and a molecular weight of 323.34 g/mol. Its IUPAC name is ethane;(Z)-4-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | ethane;(Z)-4-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 144965055 |
| Molecular Formula | C13H25NO8 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | ethane;(Z)-4-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CC.CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C11H19NO8.C2H6/c1-12(8(16)2-3-9(17)18)4-6(14)10(19)11(20)7(15)5-13;1-2/h2-3,6-7,10-11,13-15,19-20H,4-5H2,1H3,(H,17,18);1-2H3/b3-2-;/t6-,7+,10+,11+;/m0./s1 |
| InChIKey | ZHVLDDNYPDWPMS-WDKSWGHKSA-N |
| XLogP | -2.45 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|