C7H10ClNO5-2 — CID 59660855
2-[carboxylatomethyl-(3-chloro-2-hydroxypropyl)amino]acetate (PubChem CID 59660855) has the molecular formula C7H10ClNO5-2 and a molecular weight of 223.61 g/mol. Its IUPAC name is 2-[carboxylatomethyl-(3-chloro-2-hydroxypropyl)amino]acetate.
| Compound Name | 2-[carboxylatomethyl-(3-chloro-2-hydroxypropyl)amino]acetate |
|---|---|
| PubChem CID | 59660855 |
| Molecular Formula | C7H10ClNO5-2 |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-[carboxylatomethyl-(3-chloro-2-hydroxypropyl)amino]acetate |
| SMILES | O=C([O-])CN(CC(=O)[O-])CC(O)CCl |
| InChI | InChI=1S/C7H12ClNO5/c8-1-5(10)2-9(3-6(11)12)4-7(13)14/h5,10H,1-4H2,(H,11,12)(H,13,14)/p-2 |
| InChIKey | ZVTVPSDLCNRFJL-UHFFFAOYSA-L |
| XLogP | -3.61 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|