C10H14N2Na4O8 — CID 86567698
tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(2-hydroxy-2-oxidoethyl)amino]acetate (PubChem CID 86567698) has the molecular formula C10H14N2Na4O8 and a molecular weight of 382.19 g/mol. Its IUPAC name is tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(2-hydroxy-2-oxidoethyl)amino]acetate.
| Compound Name | tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(2-hydroxy-2-oxidoethyl)amino]acetate |
|---|---|
| PubChem CID | 86567698 |
| Molecular Formula | C10H14N2Na4O8 |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(2-hydroxy-2-oxidoethyl)amino]acetate |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC([O-])O)CC(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C10H17N2O8.4Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h7,13H,1-6H2,(H,15,16)(H,17,18)(H,19,20);;;;/q-1;4*+1/p-3 |
| InChIKey | NTCJOPAIBVVHPS-UHFFFAOYSA-K |
| XLogP | -19.47 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | -19.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|