C25H33NO6 — CID 162839742
(5R)-5-hydroxy-1-(8-hydroxy-3,4-dihydro-2H-chromen-5-yl)-7-[3-methoxy-4-(methylaminomethoxy)phenyl]heptan-3-one (PubChem CID 162839742) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is (5R)-5-hydroxy-1-(8-hydroxy-3,4-dihydro-2H-chromen-5-yl)-7-[3-methoxy-4-(methylaminomethoxy)phenyl]heptan-3-one.
| Compound Name | (5R)-5-hydroxy-1-(8-hydroxy-3,4-dihydro-2H-chromen-5-yl)-7-[3-methoxy-4-(methylaminomethoxy)phenyl]heptan-3-one |
|---|---|
| PubChem CID | 162839742 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (5R)-5-hydroxy-1-(8-hydroxy-3,4-dihydro-2H-chromen-5-yl)-7-[3-methoxy-4-(methylaminomethoxy)phenyl]heptan-3-one |
| SMILES | CNCOc1ccc(CC[C@@H](O)CC(=O)CCc2ccc(O)c3c2CCCO3)cc1OC |
| InChI | InChI=1S/C25H33NO6/c1-26-16-32-23-12-6-17(14-24(23)30-2)5-9-19(27)15-20(28)10-7-18-8-11-22(29)25-21(18)4-3-13-31-25/h6,8,11-12,14,19,26-27,29H,3-5,7,9-10,13,15-16H2,1-2H3/t19-/m1/s1 |
| InChIKey | HBDDRFUHGFKXEO-LJQANCHMSA-N |
| XLogP | 3.17 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|