C30H34O8 — CID 162974507
1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(8-hydroxy-3,4-dihydro-2H-chromen-5-yl)-4-[(3-hydroxyphenyl)methyl]heptan-3-one (PubChem CID 162974507) has the molecular formula C30H34O8 and a molecular weight of 522.59 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(8-hydroxy-3,4-dihydro-2H-chromen-5-yl)-4-[(3-hydroxyphenyl)methyl]heptan-3-one.
| Compound Name | 1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(8-hydroxy-3,4-dihydro-2H-chromen-5-yl)-4-[(3-hydroxyphenyl)methyl]heptan-3-one |
|---|---|
| PubChem CID | 162974507 |
| Molecular Formula | C30H34O8 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(8-hydroxy-3,4-dihydro-2H-chromen-5-yl)-4-[(3-hydroxyphenyl)methyl]heptan-3-one |
| SMILES | COc1cc(CCC(=O)C(Cc2cccc(O)c2)C(O)CCc2ccc(O)c3c2CCCO3)cc(O)c1O |
| InChI | InChI=1S/C30H34O8/c1-37-28-17-19(16-27(35)29(28)36)7-10-24(32)23(15-18-4-2-5-21(31)14-18)25(33)11-8-20-9-12-26(34)30-22(20)6-3-13-38-30/h2,4-5,9,12,14,16-17,23,25,31,33-36H,3,6-8,10-11,13,15H2,1H3 |
| InChIKey | JZACPASOKRBJQR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|