C32H42N2O7 — CID 162794807
4-[(2-amino-4-pyridinyl)methyl]-1-[3,4-dihydroxy-5-(4-methylpentoxy)phenyl]-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one (PubChem CID 162794807) has the molecular formula C32H42N2O7 and a molecular weight of 566.70 g/mol. Its IUPAC name is 4-[(2-amino-4-pyridinyl)methyl]-1-[3,4-dihydroxy-5-(4-methylpentoxy)phenyl]-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one.
| Compound Name | 4-[(2-amino-4-pyridinyl)methyl]-1-[3,4-dihydroxy-5-(4-methylpentoxy)phenyl]-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
|---|---|
| PubChem CID | 162794807 |
| Molecular Formula | C32H42N2O7 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 4-[(2-amino-4-pyridinyl)methyl]-1-[3,4-dihydroxy-5-(4-methylpentoxy)phenyl]-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
| SMILES | COc1cc(CCC(O)C(Cc2ccnc(N)c2)C(=O)CCc2cc(O)c(O)c(OCCCC(C)C)c2)ccc1O |
| InChI | InChI=1S/C32H42N2O7/c1-20(2)5-4-14-41-30-18-22(16-28(38)32(30)39)8-10-26(36)24(15-23-12-13-34-31(33)19-23)25(35)9-6-21-7-11-27(37)29(17-21)40-3/h7,11-13,16-20,24-25,35,37-39H,4-6,8-10,14-15H2,1-3H3,(H2,33,34) |
| InChIKey | PDEIBUCIVUPQEQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 155.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|