C31H40N2O8 — CID 162794809
5-(2-amino-4-pyridinyl)-1-(3,4-dihydroxy-5-methoxyphenyl)-4-[1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propyl]-8-methoxyoctan-3-one (PubChem CID 162794809) has the molecular formula C31H40N2O8 and a molecular weight of 568.67 g/mol. Its IUPAC name is 5-(2-amino-4-pyridinyl)-1-(3,4-dihydroxy-5-methoxyphenyl)-4-[1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propyl]-8-methoxyoctan-3-one.
| Compound Name | 5-(2-amino-4-pyridinyl)-1-(3,4-dihydroxy-5-methoxyphenyl)-4-[1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propyl]-8-methoxyoctan-3-one |
|---|---|
| PubChem CID | 162794809 |
| Molecular Formula | C31H40N2O8 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 5-(2-amino-4-pyridinyl)-1-(3,4-dihydroxy-5-methoxyphenyl)-4-[1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propyl]-8-methoxyoctan-3-one |
| SMILES | COCCCC(c1ccnc(N)c1)C(C(=O)CCc1cc(O)c(O)c(OC)c1)C(O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C31H40N2O8/c1-39-14-4-5-22(21-12-13-33-29(32)18-21)30(24(35)10-7-19-6-9-23(34)27(16-19)40-2)25(36)11-8-20-15-26(37)31(38)28(17-20)41-3/h6,9,12-13,15-18,22,24,30,34-35,37-38H,4-5,7-8,10-11,14H2,1-3H3,(H2,32,33) |
| InChIKey | KXIBPCLDOPOJBE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 164.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|