C33H42O7 — CID 163093853
4-benzyl-1-[3,4-dihydroxy-5-(4-methylpentoxy)phenyl]-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one (PubChem CID 163093853) has the molecular formula C33H42O7 and a molecular weight of 550.69 g/mol. Its IUPAC name is 4-benzyl-1-[3,4-dihydroxy-5-(4-methylpentoxy)phenyl]-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one.
| Compound Name | 4-benzyl-1-[3,4-dihydroxy-5-(4-methylpentoxy)phenyl]-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
|---|---|
| PubChem CID | 163093853 |
| Molecular Formula | C33H42O7 |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 4-benzyl-1-[3,4-dihydroxy-5-(4-methylpentoxy)phenyl]-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
| SMILES | COc1cc(CCC(O)C(Cc2ccccc2)C(=O)CCc2cc(O)c(O)c(OCCCC(C)C)c2)ccc1O |
| InChI | InChI=1S/C33H42O7/c1-22(2)8-7-17-40-32-21-25(19-30(37)33(32)38)13-15-28(35)26(18-23-9-5-4-6-10-23)27(34)14-11-24-12-16-29(36)31(20-24)39-3/h4-6,9-10,12,16,19-22,26-27,34,36-38H,7-8,11,13-15,17-18H2,1-3H3 |
| InChIKey | SGIIIQCVJOPRCA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|