C27H32N2O7 — CID 162794005
(4R,5R)-4-[(2-amino-4-pyridinyl)methyl]-1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one (PubChem CID 162794005) has the molecular formula C27H32N2O7 and a molecular weight of 496.56 g/mol. Its IUPAC name is (4R,5R)-4-[(2-amino-4-pyridinyl)methyl]-1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one.
| Compound Name | (4R,5R)-4-[(2-amino-4-pyridinyl)methyl]-1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
|---|---|
| PubChem CID | 162794005 |
| Molecular Formula | C27H32N2O7 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (4R,5R)-4-[(2-amino-4-pyridinyl)methyl]-1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
| SMILES | COc1cc(CC[C@@H](O)[C@@H](Cc2ccnc(N)c2)C(=O)CCc2cc(O)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C27H32N2O7/c1-35-24-13-16(4-8-22(24)32)3-6-20(30)19(11-18-9-10-29-26(28)15-18)21(31)7-5-17-12-23(33)27(34)25(14-17)36-2/h4,8-10,12-15,19-20,30,32-34H,3,5-7,11H2,1-2H3,(H2,28,29)/t19-,20-/m1/s1 |
| InChIKey | LMHUAZMRTQSLSI-WOJBJXKFSA-N |
| XLogP | 3.15 |
| TPSA | 155.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|