C31H40N2O7 — CID 163117694
4-[1-(6-amino-1,2-dihydropyridin-4-yl)cyclopentyl]-1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one (PubChem CID 163117694) has the molecular formula C31H40N2O7 and a molecular weight of 552.67 g/mol. Its IUPAC name is 4-[1-(6-amino-1,2-dihydropyridin-4-yl)cyclopentyl]-1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one.
| Compound Name | 4-[1-(6-amino-1,2-dihydropyridin-4-yl)cyclopentyl]-1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
|---|---|
| PubChem CID | 163117694 |
| Molecular Formula | C31H40N2O7 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 4-[1-(6-amino-1,2-dihydropyridin-4-yl)cyclopentyl]-1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
| SMILES | COc1cc(CCC(O)C(C(=O)CCc2cc(O)c(O)c(OC)c2)C2(C3=CCNC(N)=C3)CCCC2)ccc1O |
| InChI | InChI=1S/C31H40N2O7/c1-39-26-16-19(5-8-22(26)34)6-9-23(35)29(31(12-3-4-13-31)21-11-14-33-28(32)18-21)24(36)10-7-20-15-25(37)30(38)27(17-20)40-2/h5,8,11,15-18,23,29,33-35,37-38H,3-4,6-7,9-10,12-14,32H2,1-2H3 |
| InChIKey | AKHPEDYZTJBWTG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|