C41H44N2O8 — CID 162811405
1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-4-[1-[2-[(6-hydroxynaphthalen-2-yl)amino]-4-pyridinyl]cyclopentyl]heptan-3-one (PubChem CID 162811405) has the molecular formula C41H44N2O8 and a molecular weight of 692.81 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-4-[1-[2-[(6-hydroxynaphthalen-2-yl)amino]-4-pyridinyl]cyclopentyl]heptan-3-one.
| Compound Name | 1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-4-[1-[2-[(6-hydroxynaphthalen-2-yl)amino]-4-pyridinyl]cyclopentyl]heptan-3-one |
|---|---|
| PubChem CID | 162811405 |
| Molecular Formula | C41H44N2O8 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.31 |
| IUPAC Name | 1-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-4-[1-[2-[(6-hydroxynaphthalen-2-yl)amino]-4-pyridinyl]cyclopentyl]heptan-3-one |
| SMILES | COc1cc(CCC(O)C(C(=O)CCc2cc(O)c(O)c(OC)c2)C2(c3ccnc(Nc4ccc5cc(O)ccc5c4)c3)CCCC2)ccc1O |
| InChI | InChI=1S/C41H44N2O8/c1-50-36-20-25(5-12-32(36)45)6-13-33(46)39(34(47)14-7-26-19-35(48)40(49)37(21-26)51-2)41(16-3-4-17-41)29-15-18-42-38(24-29)43-30-10-8-28-23-31(44)11-9-27(28)22-30/h5,8-12,15,18-24,33,39,44-46,48-49H,3-4,6-7,13-14,16-17H2,1-2H3,(H,42,43) |
| InChIKey | DSZPZFVTDPMBIH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|