C35H45NO6 — CID 163099968
1-[1-(3,4-dihydroxyphenyl)-3-(methylaminomethyl)cyclohexyl]-2-hydroxy-6-(4-hydroxy-3-methoxyphenyl)-8-phenyloctan-4-one (PubChem CID 163099968) has the molecular formula C35H45NO6 and a molecular weight of 575.75 g/mol. Its IUPAC name is 1-[1-(3,4-dihydroxyphenyl)-3-(methylaminomethyl)cyclohexyl]-2-hydroxy-6-(4-hydroxy-3-methoxyphenyl)-8-phenyloctan-4-one.
| Compound Name | 1-[1-(3,4-dihydroxyphenyl)-3-(methylaminomethyl)cyclohexyl]-2-hydroxy-6-(4-hydroxy-3-methoxyphenyl)-8-phenyloctan-4-one |
|---|---|
| PubChem CID | 163099968 |
| Molecular Formula | C35H45NO6 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | 1-[1-(3,4-dihydroxyphenyl)-3-(methylaminomethyl)cyclohexyl]-2-hydroxy-6-(4-hydroxy-3-methoxyphenyl)-8-phenyloctan-4-one |
| SMILES | CNCC1CCCC(CC(O)CC(=O)CC(CCc2ccccc2)c2ccc(O)c(OC)c2)(c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C35H45NO6/c1-36-23-25-9-6-16-35(21-25,28-13-15-31(39)33(41)19-28)22-30(38)20-29(37)17-26(11-10-24-7-4-3-5-8-24)27-12-14-32(40)34(18-27)42-2/h3-5,7-8,12-15,18-19,25-26,30,36,38-41H,6,9-11,16-17,20-23H2,1-2H3 |
| InChIKey | DRCAFOOZBSTARK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|