C39H47NO6 — CID 162855603
4-benzyl-8-[1-(3,4-dihydroxyphenyl)-3-(ethylaminomethyl)cyclohexyl]-9-hydroxy-3-(4-hydroxy-3-methoxyphenyl)cyclodec-5-yn-1-one (PubChem CID 162855603) has the molecular formula C39H47NO6 and a molecular weight of 625.81 g/mol. Its IUPAC name is 4-benzyl-8-[1-(3,4-dihydroxyphenyl)-3-(ethylaminomethyl)cyclohexyl]-9-hydroxy-3-(4-hydroxy-3-methoxyphenyl)cyclodec-5-yn-1-one.
| Compound Name | 4-benzyl-8-[1-(3,4-dihydroxyphenyl)-3-(ethylaminomethyl)cyclohexyl]-9-hydroxy-3-(4-hydroxy-3-methoxyphenyl)cyclodec-5-yn-1-one |
|---|---|
| PubChem CID | 162855603 |
| Molecular Formula | C39H47NO6 |
| Molecular Weight | 625.81 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 4-benzyl-8-[1-(3,4-dihydroxyphenyl)-3-(ethylaminomethyl)cyclohexyl]-9-hydroxy-3-(4-hydroxy-3-methoxyphenyl)cyclodec-5-yn-1-one |
| SMILES | CCNCC1CCCC(c2ccc(O)c(O)c2)(C2CC#CC(Cc3ccccc3)C(c3ccc(O)c(OC)c3)CC(=O)CC2O)C1 |
| InChI | InChI=1S/C39H47NO6/c1-3-40-25-27-11-8-18-39(24-27,30-15-17-34(42)37(45)21-30)33-13-7-12-28(19-26-9-5-4-6-10-26)32(22-31(41)23-36(33)44)29-14-16-35(43)38(20-29)46-2/h4-6,9-10,14-17,20-21,27-28,32-33,36,40,42-45H,3,8,11,13,18-19,22-25H2,1-2H3 |
| InChIKey | QCHVUFIYKSUOJM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.81 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|